C17H26N2O2S — CID 120583938
2-(2,4,6-trimethylphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine (PubChem CID 120583938) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine.
| Compound Name | 2-(2,4,6-trimethylphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
|---|---|
| PubChem CID | 120583938 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CC3CCCC(N)C3C2)c(C)c1 |
| InChI | InChI=1S/C17H26N2O2S/c1-11-7-12(2)17(13(3)8-11)22(20,21)19-9-14-5-4-6-16(18)15(14)10-19/h7-8,14-16H,4-6,9-10,18H2,1-3H3 |
| InChIKey | HTXIECCUFPXOET-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |