C15H18ClN3O2S — CID 120584093
4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]-2-chlorobenzonitrile (PubChem CID 120584093) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]-2-chlorobenzonitrile.
| Compound Name | 4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 120584093 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]-2-chlorobenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CC3CCCC(N)C3C2)cc1Cl |
| InChI | InChI=1S/C15H18ClN3O2S/c16-14-6-12(5-4-10(14)7-17)22(20,21)19-8-11-2-1-3-15(18)13(11)9-19/h4-6,11,13,15H,1-3,8-9,18H2 |
| InChIKey | OLKCFXDDWMVGHE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |