C14H19Cl3N2O2S — CID 120584113
2-(2,6-dichlorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120584113) has the molecular formula C14H19Cl3N2O2S and a molecular weight of 385.74 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-(2,6-dichlorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120584113 |
| Molecular Formula | C14H19Cl3N2O2S |
| Molecular Weight | 385.74 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | Cl.NC1CCCC2CN(S(=O)(=O)c3c(Cl)cccc3Cl)CC12 |
| InChI | InChI=1S/C14H18Cl2N2O2S.ClH/c15-11-4-2-5-12(16)14(11)21(19,20)18-7-9-3-1-6-13(17)10(9)8-18;/h2,4-5,9-10,13H,1,3,6-8,17H2;1H |
| InChIKey | CWGZKCPTDJYPNW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |