C8H17N3O2S — CID 114959446
4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide (PubChem CID 114959446) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide.
| Compound Name | 4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide |
|---|---|
| PubChem CID | 114959446 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-sulfonamide |
| SMILES | NC1CCCC2CN(S(N)(=O)=O)CC12 |
| InChI | InChI=1S/C8H17N3O2S/c9-8-3-1-2-6-4-11(5-7(6)8)14(10,12)13/h6-8H,1-5,9H2,(H2,10,12,13) |
| InChIKey | KZIZELMEANASGQ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |