C14H18Cl3FN2O2S — CID 120713485
2-(2,4-dichloro-3-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120713485) has the molecular formula C14H18Cl3FN2O2S and a molecular weight of 403.73 g/mol. Its IUPAC name is 2-(2,4-dichloro-3-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-(2,4-dichloro-3-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120713485 |
| Molecular Formula | C14H18Cl3FN2O2S |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-(2,4-dichloro-3-fluorophenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | Cl.NC1CCCC2CN(S(=O)(=O)c3ccc(Cl)c(F)c3Cl)CC12 |
| InChI | InChI=1S/C14H17Cl2FN2O2S.ClH/c15-10-4-5-12(13(16)14(10)17)22(20,21)19-6-8-2-1-3-11(18)9(8)7-19;/h4-5,8-9,11H,1-3,6-7,18H2;1H |
| InChIKey | NCAYKSBFDJLKJZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|