C12H13Cl2FN2O2S — CID 103089094
5-(2,4-dichloro-3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 103089094) has the molecular formula C12H13Cl2FN2O2S and a molecular weight of 339.22 g/mol. Its IUPAC name is 5-(2,4-dichloro-3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2,4-dichloro-3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 103089094 |
| Molecular Formula | C12H13Cl2FN2O2S |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-(2,4-dichloro-3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(c1ccc(Cl)c(F)c1Cl)N1CC2CNCC2C1 |
| InChI | InChI=1S/C12H13Cl2FN2O2S/c13-9-1-2-10(11(14)12(9)15)20(18,19)17-5-7-3-16-4-8(7)6-17/h1-2,7-8,16H,3-6H2 |
| InChIKey | ANFWMQZKUCHKMU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|