C12H14BrFN2O2S — CID 116527932
5-(4-bromo-2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 116527932) has the molecular formula C12H14BrFN2O2S and a molecular weight of 349.23 g/mol. Its IUPAC name is 5-(4-bromo-2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(4-bromo-2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 116527932 |
| Molecular Formula | C12H14BrFN2O2S |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 5-(4-bromo-2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(c1ccc(Br)cc1F)N1CC2CNCC2C1 |
| InChI | InChI=1S/C12H14BrFN2O2S/c13-10-1-2-12(11(14)3-10)19(17,18)16-6-8-4-15-5-9(8)7-16/h1-3,8-9,15H,4-7H2 |
| InChIKey | BJJZDOFYDGTWFG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |