C13H16BrFN2O2S — CID 116527823
1-(4-bromo-2-fluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 116527823) has the molecular formula C13H16BrFN2O2S and a molecular weight of 363.25 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 116527823 |
| Molecular Formula | C13H16BrFN2O2S |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | CC1CC2CNCC2N1S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H16BrFN2O2S/c1-8-4-9-6-16-7-12(9)17(8)20(18,19)13-3-2-10(14)5-11(13)15/h2-3,5,8-9,12,16H,4,6-7H2,1H3 |
| InChIKey | KJUMYKNKZDOXMW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |