C12H17BrClFN2O2S — CID 120712878
1-(4-bromo-2-fluorophenyl)sulfonyl-2,5-dimethylpiperazine;hydrochloride (PubChem CID 120712878) has the molecular formula C12H17BrClFN2O2S and a molecular weight of 387.70 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)sulfonyl-2,5-dimethylpiperazine;hydrochloride.
| Compound Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2,5-dimethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120712878 |
| Molecular Formula | C12H17BrClFN2O2S |
| Molecular Weight | 387.70 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-2,5-dimethylpiperazine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Br)cc2F)C(C)CN1.Cl |
| InChI | InChI=1S/C12H16BrFN2O2S.ClH/c1-8-7-16(9(2)6-15-8)19(17,18)12-4-3-10(13)5-11(12)14;/h3-5,8-9,15H,6-7H2,1-2H3;1H |
| InChIKey | VOJFMGMUKGIHJS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.70 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |