C13H18BrFN2O2S — CID 114389646
4-(4-bromo-2-fluorophenyl)sulfonyl-1,2,6-trimethylpiperazine (PubChem CID 114389646) has the molecular formula C13H18BrFN2O2S and a molecular weight of 365.27 g/mol. Its IUPAC name is 4-(4-bromo-2-fluorophenyl)sulfonyl-1,2,6-trimethylpiperazine.
| Compound Name | 4-(4-bromo-2-fluorophenyl)sulfonyl-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 114389646 |
| Molecular Formula | C13H18BrFN2O2S |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 4-(4-bromo-2-fluorophenyl)sulfonyl-1,2,6-trimethylpiperazine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Br)cc2F)CC(C)N1C |
| InChI | InChI=1S/C13H18BrFN2O2S/c1-9-7-17(8-10(2)16(9)3)20(18,19)13-5-4-11(14)6-12(13)15/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | PUSNEBHSOXBTSM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |