C13H20FN3O2S — CID 114542775
4-fluoro-2-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline (PubChem CID 114542775) has the molecular formula C13H20FN3O2S and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-fluoro-2-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 4-fluoro-2-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 114542775 |
| Molecular Formula | C13H20FN3O2S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-fluoro-2-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline |
| SMILES | CC1CN(S(=O)(=O)c2cc(F)ccc2N)CC(C)N1C |
| InChI | InChI=1S/C13H20FN3O2S/c1-9-7-17(8-10(2)16(9)3)20(18,19)13-6-11(14)4-5-12(13)15/h4-6,9-10H,7-8,15H2,1-3H3 |
| InChIKey | YDHQDXHRUJBOFH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|