C13H19F2N3O2S — CID 114542789
3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline (PubChem CID 114542789) has the molecular formula C13H19F2N3O2S and a molecular weight of 319.38 g/mol. Its IUPAC name is 3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 114542789 |
| Molecular Formula | C13H19F2N3O2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)sulfonylaniline |
| SMILES | CC1CN(S(=O)(=O)c2c(F)cc(N)cc2F)CC(C)N1C |
| InChI | InChI=1S/C13H19F2N3O2S/c1-8-6-18(7-9(2)17(8)3)21(19,20)13-11(14)4-10(16)5-12(13)15/h4-5,8-9H,6-7,16H2,1-3H3 |
| InChIKey | HYVCACZXIDAGLO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|