C11H14F2N2O3S — CID 54888968
3,5-difluoro-4-(2-methylmorpholin-4-yl)sulfonylaniline (PubChem CID 54888968) has the molecular formula C11H14F2N2O3S and a molecular weight of 292.31 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-methylmorpholin-4-yl)sulfonylaniline.
| Compound Name | 3,5-difluoro-4-(2-methylmorpholin-4-yl)sulfonylaniline |
|---|---|
| PubChem CID | 54888968 |
| Molecular Formula | C11H14F2N2O3S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3,5-difluoro-4-(2-methylmorpholin-4-yl)sulfonylaniline |
| SMILES | CC1CN(S(=O)(=O)c2c(F)cc(N)cc2F)CCO1 |
| InChI | InChI=1S/C11H14F2N2O3S/c1-7-6-15(2-3-18-7)19(16,17)11-9(12)4-8(14)5-10(11)13/h4-5,7H,2-3,6,14H2,1H3 |
| InChIKey | WRIRQFIMTNLANZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|