C12H15F2NO4S — CID 105116842
[3,4-difluoro-5-(2-methylmorpholin-4-yl)sulfonylphenyl]methanol (PubChem CID 105116842) has the molecular formula C12H15F2NO4S and a molecular weight of 307.32 g/mol. Its IUPAC name is [3,4-difluoro-5-(2-methylmorpholin-4-yl)sulfonylphenyl]methanol.
| Compound Name | [3,4-difluoro-5-(2-methylmorpholin-4-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 105116842 |
| Molecular Formula | C12H15F2NO4S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [3,4-difluoro-5-(2-methylmorpholin-4-yl)sulfonylphenyl]methanol |
| SMILES | CC1CN(S(=O)(=O)c2cc(CO)cc(F)c2F)CCO1 |
| InChI | InChI=1S/C12H15F2NO4S/c1-8-6-15(2-3-19-8)20(17,18)11-5-9(7-16)4-10(13)12(11)14/h4-5,8,16H,2-3,6-7H2,1H3 |
| InChIKey | FSHKWQVSHNAVQD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |