C13H16ClF2NO3S — CID 105118400
1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3-(methoxymethyl)pyrrolidine (PubChem CID 105118400) has the molecular formula C13H16ClF2NO3S and a molecular weight of 339.79 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3-(methoxymethyl)pyrrolidine.
| Compound Name | 1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 105118400 |
| Molecular Formula | C13H16ClF2NO3S |
| Molecular Weight | 339.79 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3-(methoxymethyl)pyrrolidine |
| SMILES | COCC1CCN(S(=O)(=O)c2cc(CCl)cc(F)c2F)C1 |
| InChI | InChI=1S/C13H16ClF2NO3S/c1-20-8-9-2-3-17(7-9)21(18,19)12-5-10(6-14)4-11(15)13(12)16/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | BTZZKPFLAKOYJV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.79 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|