C14H16ClF2NO2S — CID 105118472
2-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 105118472) has the molecular formula C14H16ClF2NO2S and a molecular weight of 335.80 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 105118472 |
| Molecular Formula | C14H16ClF2NO2S |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | O=S(=O)(c1cc(CCl)cc(F)c1F)N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H16ClF2NO2S/c15-6-9-4-12(16)14(17)13(5-9)21(19,20)18-7-10-2-1-3-11(10)8-18/h4-5,10-11H,1-3,6-8H2 |
| InChIKey | MPFTWIXBADGGER-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|