C13H16ClF2NO2S2 — CID 105118383
4-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-2,6-dimethylthiomorpholine (PubChem CID 105118383) has the molecular formula C13H16ClF2NO2S2 and a molecular weight of 355.86 g/mol. Its IUPAC name is 4-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-2,6-dimethylthiomorpholine.
| Compound Name | 4-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-2,6-dimethylthiomorpholine |
|---|---|
| PubChem CID | 105118383 |
| Molecular Formula | C13H16ClF2NO2S2 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 4-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-2,6-dimethylthiomorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cc(CCl)cc(F)c2F)CC(C)S1 |
| InChI | InChI=1S/C13H16ClF2NO2S2/c1-8-6-17(7-9(2)20-8)21(18,19)12-4-10(5-14)3-11(15)13(12)16/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | DPSNRTSKODOQQB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|