C12H16F2N2O2S2 — CID 107343588
3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2,6-difluoroaniline (PubChem CID 107343588) has the molecular formula C12H16F2N2O2S2 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2,6-difluoroaniline.
| Compound Name | 3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2,6-difluoroaniline |
|---|---|
| PubChem CID | 107343588 |
| Molecular Formula | C12H16F2N2O2S2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2,6-difluoroaniline |
| SMILES | CC1CN(S(=O)(=O)c2ccc(F)c(N)c2F)CC(C)S1 |
| InChI | InChI=1S/C12H16F2N2O2S2/c1-7-5-16(6-8(2)19-7)20(17,18)10-4-3-9(13)12(15)11(10)14/h3-4,7-8H,5-6,15H2,1-2H3 |
| InChIKey | BXCTYOPUHKZURL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|