C13H15F2N3O2S — CID 107343317
2,6-difluoro-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline (PubChem CID 107343317) has the molecular formula C13H15F2N3O2S and a molecular weight of 315.34 g/mol. Its IUPAC name is 2,6-difluoro-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 2,6-difluoro-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 107343317 |
| Molecular Formula | C13H15F2N3O2S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2,6-difluoro-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline |
| SMILES | C#CCN1CCN(S(=O)(=O)c2ccc(F)c(N)c2F)CC1 |
| InChI | InChI=1S/C13H15F2N3O2S/c1-2-5-17-6-8-18(9-7-17)21(19,20)11-4-3-10(14)13(16)12(11)15/h1,3-4H,5-9,16H2 |
| InChIKey | XMSAWMKXTVHMIY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|