C15H21N3O2S — CID 61139574
2,4-dimethyl-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline (PubChem CID 61139574) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2,4-dimethyl-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 2,4-dimethyl-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 61139574 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2,4-dimethyl-3-(4-prop-2-ynylpiperazin-1-yl)sulfonylaniline |
| SMILES | C#CCN1CCN(S(=O)(=O)c2c(C)ccc(N)c2C)CC1 |
| InChI | InChI=1S/C15H21N3O2S/c1-4-7-17-8-10-18(11-9-17)21(19,20)15-12(2)5-6-14(16)13(15)3/h1,5-6H,7-11,16H2,2-3H3 |
| InChIKey | LBBFPSYPYZQCEV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|