C13H15F3N2O4S — CID 26947786
ethyl 4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 26947786) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is ethyl 4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 26947786 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | ethyl 4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C13H15F3N2O4S/c1-2-22-13(19)17-5-7-18(8-6-17)23(20,21)10-4-3-9(14)11(15)12(10)16/h3-4H,2,5-8H2,1H3 |
| InChIKey | FNUFJIUIIICXCQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|