C13H16Cl2N2O4S — CID 26947781
ethyl 4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 26947781) has the molecular formula C13H16Cl2N2O4S and a molecular weight of 367.25 g/mol. Its IUPAC name is ethyl 4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 26947781 |
| Molecular Formula | C13H16Cl2N2O4S |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | ethyl 4-(2,3-dichlorophenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O4S/c1-2-21-13(18)16-6-8-17(9-7-16)22(19,20)11-5-3-4-10(14)12(11)15/h3-5H,2,6-9H2,1H3 |
| InChIKey | LMDDJXLKFAKHGB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |