C14H19BrN2O4S — CID 55565612
ethyl 4-(2-bromo-4-methylphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 55565612) has the molecular formula C14H19BrN2O4S and a molecular weight of 391.29 g/mol. Its IUPAC name is ethyl 4-(2-bromo-4-methylphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-(2-bromo-4-methylphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 55565612 |
| Molecular Formula | C14H19BrN2O4S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | ethyl 4-(2-bromo-4-methylphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc(C)cc2Br)CC1 |
| InChI | InChI=1S/C14H19BrN2O4S/c1-3-21-14(18)16-6-8-17(9-7-16)22(19,20)13-5-4-11(2)10-12(13)15/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | GQBHYJMWKCVRGP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |