C13H18BrN3O3S — CID 52865112
4-(2-bromo-4-methylphenyl)sulfonyl-1,4-diazepane-1-carboxamide (PubChem CID 52865112) has the molecular formula C13H18BrN3O3S and a molecular weight of 376.28 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenyl)sulfonyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2-bromo-4-methylphenyl)sulfonyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 52865112 |
| Molecular Formula | C13H18BrN3O3S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 4-(2-bromo-4-methylphenyl)sulfonyl-1,4-diazepane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(C(N)=O)CC2)c(Br)c1 |
| InChI | InChI=1S/C13H18BrN3O3S/c1-10-3-4-12(11(14)9-10)21(19,20)17-6-2-5-16(7-8-17)13(15)18/h3-4,9H,2,5-8H2,1H3,(H2,15,18) |
| InChIKey | YHKUGLIDHDWECP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |