C17H16Br4N2O4S2 — CID 21210164
1,4-bis[(2,4-dibromophenyl)sulfonyl]-1,4-diazepane (PubChem CID 21210164) has the molecular formula C17H16Br4N2O4S2 and a molecular weight of 696.07 g/mol. Its IUPAC name is 1,4-bis[(2,4-dibromophenyl)sulfonyl]-1,4-diazepane.
| Compound Name | 1,4-bis[(2,4-dibromophenyl)sulfonyl]-1,4-diazepane |
|---|---|
| PubChem CID | 21210164 |
| Molecular Formula | C17H16Br4N2O4S2 |
| Molecular Weight | 696.07 g/mol |
| Exact Mass | 691.73 |
| IUPAC Name | 1,4-bis[(2,4-dibromophenyl)sulfonyl]-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc(Br)cc1Br)N1CCCN(S(=O)(=O)c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C17H16Br4N2O4S2/c18-12-2-4-16(14(20)10-12)28(24,25)22-6-1-7-23(9-8-22)29(26,27)17-5-3-13(19)11-15(17)21/h2-5,10-11H,1,6-9H2 |
| InChIKey | ZOTMEOYZLUTZRU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.07 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |