C12H13Br2NO4S — CID 60824521
1-(2,4-dibromophenyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 60824521) has the molecular formula C12H13Br2NO4S and a molecular weight of 427.11 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 1-(2,4-dibromophenyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 60824521 |
| Molecular Formula | C12H13Br2NO4S |
| Molecular Weight | 427.11 g/mol |
| Exact Mass | 424.89 |
| IUPAC Name | 1-(2,4-dibromophenyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)c2ccc(Br)cc2Br)C1 |
| InChI | InChI=1S/C12H13Br2NO4S/c13-9-3-4-11(10(14)6-9)20(18,19)15-5-1-2-8(7-15)12(16)17/h3-4,6,8H,1-2,5,7H2,(H,16,17) |
| InChIKey | OUMRTGPGFDKLMS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |