C10H12BrNO4S2 — CID 81120170
(3R)-1-(3-bromothiophen-2-yl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 81120170) has the molecular formula C10H12BrNO4S2 and a molecular weight of 354.25 g/mol. Its IUPAC name is (3R)-1-(3-bromothiophen-2-yl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(3-bromothiophen-2-yl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81120170 |
| Molecular Formula | C10H12BrNO4S2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | (3R)-1-(3-bromothiophen-2-yl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(S(=O)(=O)c2sccc2Br)C1 |
| InChI | InChI=1S/C10H12BrNO4S2/c11-8-3-5-17-10(8)18(15,16)12-4-1-2-7(6-12)9(13)14/h3,5,7H,1-2,4,6H2,(H,13,14)/t7-/m1/s1 |
| InChIKey | JWPGAANJXLHQPZ-SSDOTTSWSA-N |
| XLogP | 2.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |