C8H10BrNO4S2 — CID 106672713
1-(3-bromothiophen-2-yl)sulfonylpyrrolidine-3,4-diol (PubChem CID 106672713) has the molecular formula C8H10BrNO4S2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | 1-(3-bromothiophen-2-yl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672713 |
| Molecular Formula | C8H10BrNO4S2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)sulfonylpyrrolidine-3,4-diol |
| SMILES | O=S(=O)(c1sccc1Br)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C8H10BrNO4S2/c9-5-1-2-15-8(5)16(13,14)10-3-6(11)7(12)4-10/h1-2,6-7,11-12H,3-4H2 |
| InChIKey | XZMKYPQPBZZKGW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |