C9H13BrN2O2S2 — CID 104976618
(3S)-1-(3-bromothiophen-2-yl)sulfonyl-3-methylpiperazine (PubChem CID 104976618) has the molecular formula C9H13BrN2O2S2 and a molecular weight of 325.25 g/mol. Its IUPAC name is (3S)-1-(3-bromothiophen-2-yl)sulfonyl-3-methylpiperazine.
| Compound Name | (3S)-1-(3-bromothiophen-2-yl)sulfonyl-3-methylpiperazine |
|---|---|
| PubChem CID | 104976618 |
| Molecular Formula | C9H13BrN2O2S2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | (3S)-1-(3-bromothiophen-2-yl)sulfonyl-3-methylpiperazine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2sccc2Br)CCN1 |
| InChI | InChI=1S/C9H13BrN2O2S2/c1-7-6-12(4-3-11-7)16(13,14)9-8(10)2-5-15-9/h2,5,7,11H,3-4,6H2,1H3/t7-/m0/s1 |
| InChIKey | ZRLVOSYGNNDWLJ-ZETCQYMHSA-N |
| XLogP | 1.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |