C10H16N2O3S2 — CID 124619167
(3R)-1-(3-methoxythiophen-2-yl)sulfonyl-3-methylpiperazine (PubChem CID 124619167) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3R)-1-(3-methoxythiophen-2-yl)sulfonyl-3-methylpiperazine.
| Compound Name | (3R)-1-(3-methoxythiophen-2-yl)sulfonyl-3-methylpiperazine |
|---|---|
| PubChem CID | 124619167 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (3R)-1-(3-methoxythiophen-2-yl)sulfonyl-3-methylpiperazine |
| SMILES | COc1ccsc1S(=O)(=O)N1CCN[C@H](C)C1 |
| InChI | InChI=1S/C10H16N2O3S2/c1-8-7-12(5-4-11-8)17(13,14)10-9(15-2)3-6-16-10/h3,6,8,11H,4-5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | RVBIHKXOIPVVQC-MRVPVSSYSA-N |
| XLogP | 0.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |