C14H22N2O4S — CID 104976424
(3S)-1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-3-methylpiperazine (PubChem CID 104976424) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is (3S)-1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-3-methylpiperazine.
| Compound Name | (3S)-1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-3-methylpiperazine |
|---|---|
| PubChem CID | 104976424 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (3S)-1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-3-methylpiperazine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCN[C@@H](C)C2)cc1OC |
| InChI | InChI=1S/C14H22N2O4S/c1-10-7-12(19-3)13(20-4)8-14(10)21(17,18)16-6-5-15-11(2)9-16/h7-8,11,15H,5-6,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | XSXPPIOXCZKEAD-NSHDSACASA-N |
| XLogP | 0.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |