C20H32N2O4S — CID 86900555
1-[1-(4,5-dimethoxy-2-methylphenyl)sulfonylpiperidin-3-yl]azepane (PubChem CID 86900555) has the molecular formula C20H32N2O4S and a molecular weight of 396.55 g/mol. Its IUPAC name is 1-[1-(4,5-dimethoxy-2-methylphenyl)sulfonylpiperidin-3-yl]azepane.
| Compound Name | 1-[1-(4,5-dimethoxy-2-methylphenyl)sulfonylpiperidin-3-yl]azepane |
|---|---|
| PubChem CID | 86900555 |
| Molecular Formula | C20H32N2O4S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-[1-(4,5-dimethoxy-2-methylphenyl)sulfonylpiperidin-3-yl]azepane |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCC(N3CCCCCC3)C2)cc1OC |
| InChI | InChI=1S/C20H32N2O4S/c1-16-13-18(25-2)19(26-3)14-20(16)27(23,24)22-12-8-9-17(15-22)21-10-6-4-5-7-11-21/h13-14,17H,4-12,15H2,1-3H3 |
| InChIKey | ZAOWZAQCCNRVNM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |