C14H21NO3S — CID 801464
1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidine (PubChem CID 801464) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidine.
| Compound Name | 1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 801464 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(4-methoxy-2,5-dimethylphenyl)sulfonylpiperidine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCCC2)cc1C |
| InChI | InChI=1S/C14H21NO3S/c1-11-10-14(12(2)9-13(11)18-3)19(16,17)15-7-5-4-6-8-15/h9-10H,4-8H2,1-3H3 |
| InChIKey | NUSDJXOQJGBIIP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |