C14H23ClN2O4S — CID 119963342
1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-1,4-diazepane;hydrochloride (PubChem CID 119963342) has the molecular formula C14H23ClN2O4S and a molecular weight of 350.87 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-1,4-diazepane;hydrochloride.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119963342 |
| Molecular Formula | C14H23ClN2O4S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-1,4-diazepane;hydrochloride |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCNCC2)cc1OC.Cl |
| InChI | InChI=1S/C14H22N2O4S.ClH/c1-11-9-12(19-2)13(20-3)10-14(11)21(17,18)16-7-4-5-15-6-8-16;/h9-10,15H,4-8H2,1-3H3;1H |
| InChIKey | SODQHFMVOMBEMZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |