C13H18FNO5S — CID 43502996
1-(2-fluoro-4,5-dimethoxyphenyl)sulfonylpiperidin-3-ol (PubChem CID 43502996) has the molecular formula C13H18FNO5S and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-(2-fluoro-4,5-dimethoxyphenyl)sulfonylpiperidin-3-ol.
| Compound Name | 1-(2-fluoro-4,5-dimethoxyphenyl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 43502996 |
| Molecular Formula | C13H18FNO5S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 1-(2-fluoro-4,5-dimethoxyphenyl)sulfonylpiperidin-3-ol |
| SMILES | COc1cc(F)c(S(=O)(=O)N2CCCC(O)C2)cc1OC |
| InChI | InChI=1S/C13H18FNO5S/c1-19-11-6-10(14)13(7-12(11)20-2)21(17,18)15-5-3-4-9(16)8-15/h6-7,9,16H,3-5,8H2,1-2H3 |
| InChIKey | GCVSWGHARURGJK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |