C12H15BrClNO4S — CID 43502998
1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-ol (PubChem CID 43502998) has the molecular formula C12H15BrClNO4S and a molecular weight of 384.68 g/mol. Its IUPAC name is 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-ol.
| Compound Name | 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 43502998 |
| Molecular Formula | C12H15BrClNO4S |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-ol |
| SMILES | COc1c(Br)cc(Cl)cc1S(=O)(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C12H15BrClNO4S/c1-19-12-10(13)5-8(14)6-11(12)20(17,18)15-4-2-3-9(16)7-15/h5-6,9,16H,2-4,7H2,1H3 |
| InChIKey | YAWKVFUKXOJIBI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |