C13H18BrClN2O3S — CID 62536928
1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonyl-N-methylpiperidin-3-amine (PubChem CID 62536928) has the molecular formula C13H18BrClN2O3S and a molecular weight of 397.72 g/mol. Its IUPAC name is 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonyl-N-methylpiperidin-3-amine.
| Compound Name | 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonyl-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 62536928 |
| Molecular Formula | C13H18BrClN2O3S |
| Molecular Weight | 397.72 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonyl-N-methylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2cc(Cl)cc(Br)c2OC)C1 |
| InChI | InChI=1S/C13H18BrClN2O3S/c1-16-10-4-3-5-17(8-10)21(18,19)12-7-9(15)6-11(14)13(12)20-2/h6-7,10,16H,3-5,8H2,1-2H3 |
| InChIKey | PXNPMCRKNOTVMB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |