C10H14BrClN2O2S2 — CID 120715299
1-(5-bromo-2-chlorothiophen-3-yl)sulfonyl-N-methylpiperidin-3-amine (PubChem CID 120715299) has the molecular formula C10H14BrClN2O2S2 and a molecular weight of 373.73 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorothiophen-3-yl)sulfonyl-N-methylpiperidin-3-amine.
| Compound Name | 1-(5-bromo-2-chlorothiophen-3-yl)sulfonyl-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 120715299 |
| Molecular Formula | C10H14BrClN2O2S2 |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 1-(5-bromo-2-chlorothiophen-3-yl)sulfonyl-N-methylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2cc(Br)sc2Cl)C1 |
| InChI | InChI=1S/C10H14BrClN2O2S2/c1-13-7-3-2-4-14(6-7)18(15,16)8-5-9(11)17-10(8)12/h5,7,13H,2-4,6H2,1H3 |
| InChIKey | HMEBXEMTIRWLSS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |