C16H19ClN2O2S — CID 120715283
1-(4-chloronaphthalen-1-yl)sulfonyl-N-methylpiperidin-3-amine (PubChem CID 120715283) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)sulfonyl-N-methylpiperidin-3-amine.
| Compound Name | 1-(4-chloronaphthalen-1-yl)sulfonyl-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 120715283 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)sulfonyl-N-methylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2ccc(Cl)c3ccccc23)C1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-18-12-5-4-10-19(11-12)22(20,21)16-9-8-15(17)13-6-2-3-7-14(13)16/h2-3,6-9,12,18H,4-5,10-11H2,1H3 |
| InChIKey | WSFNPVHHLDMLIQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |