C12H15F3N2O2S — CID 62534665
N-methyl-1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-amine (PubChem CID 62534665) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is N-methyl-1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-amine.
| Compound Name | N-methyl-1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 62534665 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-methyl-1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-16-8-3-2-6-17(7-8)20(18,19)10-5-4-9(13)11(14)12(10)15/h4-5,8,16H,2-3,6-7H2,1H3 |
| InChIKey | PRGXBJYPJYAKJC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|