C12H16ClF3N2O2S — CID 120714757
N-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 120714757) has the molecular formula C12H16ClF3N2O2S and a molecular weight of 344.79 g/mol. Its IUPAC name is N-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120714757 |
| Molecular Formula | C12H16ClF3N2O2S |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(S(=O)(=O)c2cc(F)c(F)c(F)c2)C1.Cl |
| InChI | InChI=1S/C12H15F3N2O2S.ClH/c1-16-8-3-2-4-17(7-8)20(18,19)9-5-10(13)12(15)11(14)6-9;/h5-6,8,16H,2-4,7H2,1H3;1H |
| InChIKey | GWVPHINDRPZKMO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|