C13H21ClN2O2S2 — CID 120714741
N-methyl-1-(4-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 120714741) has the molecular formula C13H21ClN2O2S2 and a molecular weight of 336.91 g/mol. Its IUPAC name is N-methyl-1-(4-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-(4-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120714741 |
| Molecular Formula | C13H21ClN2O2S2 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-methyl-1-(4-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(S(=O)(=O)c2ccc(SC)cc2)C1.Cl |
| InChI | InChI=1S/C13H20N2O2S2.ClH/c1-14-11-4-3-9-15(10-11)19(16,17)13-7-5-12(18-2)6-8-13;/h5-8,11,14H,3-4,9-10H2,1-2H3;1H |
| InChIKey | KACXHRVHCUJUNB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |