C17H27N3O6S3 — CID 55663474
N-[1-(4-piperidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanesulfonamide (PubChem CID 55663474) has the molecular formula C17H27N3O6S3 and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[1-(4-piperidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(4-piperidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 55663474 |
| Molecular Formula | C17H27N3O6S3 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[1-(4-piperidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C17H27N3O6S3/c1-27(21,22)18-15-6-5-13-20(14-15)29(25,26)17-9-7-16(8-10-17)28(23,24)19-11-3-2-4-12-19/h7-10,15,18H,2-6,11-14H2,1H3 |
| InChIKey | SZZNTDRCLDTYDP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |