C15H23N3O6S3 — CID 97257934
(3S)-1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidine-3-sulfonamide (PubChem CID 97257934) has the molecular formula C15H23N3O6S3 and a molecular weight of 437.57 g/mol. Its IUPAC name is (3S)-1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidine-3-sulfonamide.
| Compound Name | (3S)-1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97257934 |
| Molecular Formula | C15H23N3O6S3 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | (3S)-1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)[C@H]1CCCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C15H23N3O6S3/c16-25(19,20)15-4-3-11-18(12-15)27(23,24)14-7-5-13(6-8-14)26(21,22)17-9-1-2-10-17/h5-8,15H,1-4,9-12H2,(H2,16,19,20)/t15-/m0/s1 |
| InChIKey | PZTRTCNKGFTPEE-HNNXBMFYSA-N |
| XLogP | -0.09 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |