C10H14FN3O4S2 — CID 103302923
1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-3-sulfonamide (PubChem CID 103302923) has the molecular formula C10H14FN3O4S2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-3-sulfonamide.
| Compound Name | 1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 103302923 |
| Molecular Formula | C10H14FN3O4S2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CCCN(S(=O)(=O)c2ncccc2F)C1 |
| InChI | InChI=1S/C10H14FN3O4S2/c11-9-4-1-5-13-10(9)20(17,18)14-6-2-3-8(7-14)19(12,15)16/h1,4-5,8H,2-3,6-7H2,(H2,12,15,16) |
| InChIKey | MOPGVEHHJJWYCJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |