C11H15FN2O3S — CID 103299267
[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-3-yl]methanol (PubChem CID 103299267) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is [1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-3-yl]methanol.
| Compound Name | [1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 103299267 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-3-yl]methanol |
| SMILES | O=S(=O)(c1ncccc1F)N1CCCC(CO)C1 |
| InChI | InChI=1S/C11H15FN2O3S/c12-10-4-1-5-13-11(10)18(16,17)14-6-2-3-9(7-14)8-15/h1,4-5,9,15H,2-3,6-8H2 |
| InChIKey | OWZJBOYOBHHGML-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |