C10H13FN2O2S — CID 103299830
3-fluoro-2-(3-methylpyrrolidin-1-yl)sulfonylpyridine (PubChem CID 103299830) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-fluoro-2-(3-methylpyrrolidin-1-yl)sulfonylpyridine.
| Compound Name | 3-fluoro-2-(3-methylpyrrolidin-1-yl)sulfonylpyridine |
|---|---|
| PubChem CID | 103299830 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-fluoro-2-(3-methylpyrrolidin-1-yl)sulfonylpyridine |
| SMILES | CC1CCN(S(=O)(=O)c2ncccc2F)C1 |
| InChI | InChI=1S/C10H13FN2O2S/c1-8-4-6-13(7-8)16(14,15)10-9(11)3-2-5-12-10/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | GCWQIVUSWUIGRE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |