C14H22FN3O2S — CID 103298412
N-ethyl-1-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]ethanamine (PubChem CID 103298412) has the molecular formula C14H22FN3O2S and a molecular weight of 315.41 g/mol. Its IUPAC name is N-ethyl-1-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]ethanamine.
| Compound Name | N-ethyl-1-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 103298412 |
| Molecular Formula | C14H22FN3O2S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-ethyl-1-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]ethanamine |
| SMILES | CCNC(C)C1CCN(S(=O)(=O)c2ncccc2F)CC1 |
| InChI | InChI=1S/C14H22FN3O2S/c1-3-16-11(2)12-6-9-18(10-7-12)21(19,20)14-13(15)5-4-8-17-14/h4-5,8,11-12,16H,3,6-7,9-10H2,1-2H3 |
| InChIKey | OOHJSVHNWNCLAC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |