C12H15FN2O4S — CID 103298867
2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]acetic acid (PubChem CID 103298867) has the molecular formula C12H15FN2O4S and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 103298867 |
| Molecular Formula | C12H15FN2O4S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(S(=O)(=O)c2ncccc2F)CC1 |
| InChI | InChI=1S/C12H15FN2O4S/c13-10-2-1-5-14-12(10)20(18,19)15-6-3-9(4-7-15)8-11(16)17/h1-2,5,9H,3-4,6-8H2,(H,16,17) |
| InChIKey | QZZNCIXHOHIIGN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |