C11H12FN3O5S — CID 103298814
2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 103298814) has the molecular formula C11H12FN3O5S and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 103298814 |
| Molecular Formula | C11H12FN3O5S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[1-[(3-fluoro-2-pyridinyl)sulfonyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1C(=O)NCCN1S(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C11H12FN3O5S/c12-7-2-1-3-14-11(7)21(19,20)15-5-4-13-10(18)8(15)6-9(16)17/h1-3,8H,4-6H2,(H,13,18)(H,16,17) |
| InChIKey | HBPKKDDRBVCWAR-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |